EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C42H42N4O2 |
| Net Charge | 0 |
| Average Mass | 634.824 |
| Monoisotopic Mass | 634.33078 |
| SMILES | [H][C@]12C=CC(=O)N3c4ccccc4[C@@]4(C[C@H](C5=CC6[C@@]7([H])C[C@]8([H])N(CC[C@@]89c8ccccc8N(C5=O)[C@@]69[H])C/C7=C/C)N5C/C(=C/C)[C@]1([H])C[C@]54[H])[C@@]32[H] |
| InChI | InChI=1S/C42H42N4O2/c1-3-23-21-43-16-15-41-30-9-5-8-12-33(30)46-39(41)28(27(23)18-35(41)43)17-29(40(46)48)34-20-42-31-10-6-7-11-32(31)45-37(47)14-13-25(38(42)45)26-19-36(42)44(34)22-24(26)4-2/h3-14,17,25-28,34-36,38-39H,15-16,18-22H2,1-2H3/b23-3-,24-4-/t25-,26-,27-,28?,34+,35-,36-,38-,39-,41+,42+/m0/s1 |
| InChIKey | VCDMHIARBYKHSB-GGFWQZPHSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Sungucine (CHEBI:141958) is a monoterpenoid indole alkaloid (CHEBI:65323) |