EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H43N5O2 |
| Net Charge | 0 |
| Average Mass | 565.762 |
| Monoisotopic Mass | 565.34168 |
| SMILES | [H][C@]1(C[C@@]2([H])c3nc4ccccc4c3CCN2C)C[C@]2([H])N(CCC23C(O)=Nc2c3ccc(O)c2[C@H]2CCCN2C)C[C@@H]1C=C |
| InChI | InChI=1S/C35H43N5O2/c1-4-21-20-40-17-14-35(25-11-12-29(41)31(33(25)37-34(35)42)27-10-7-15-38(27)2)30(40)19-22(21)18-28-32-24(13-16-39(28)3)23-8-5-6-9-26(23)36-32/h4-6,8-9,11-12,21-22,27-28,30,36,41H,1,7,10,13-20H2,2-3H3,(H,37,42)/t21-,22-,27+,28-,30-,35?/m0/s1 |
| InChIKey | AMTATQQZOONDAP-LUGSFZSZSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Strychnophylline (CHEBI:141957) is a monoterpenoid indole alkaloid (CHEBI:65323) |