EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H26N2O4 |
| Net Charge | 0 |
| Average Mass | 370.449 |
| Monoisotopic Mass | 370.18926 |
| SMILES | [H][C@]12CO[C@H](C)[C@]3([H])CN4CC[C@@]5(c6ccccc6N(C(=O)CO)[C@@]15[H])[C@]4(O)C[C@]23[H] |
| InChI | InChI=1S/C21H26N2O4/c1-12-14-9-22-7-6-20-16-4-2-3-5-17(16)23(18(25)10-24)19(20)15(11-27-12)13(14)8-21(20,22)26/h2-5,12-15,19,24,26H,6-11H2,1H3/t12-,13+,14+,15-,19+,20+,21-/m1/s1 |
| InChIKey | PUJOYKKZYBTUSK-LQOCACJHSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Splendoline (CHEBI:141952) is a monoterpenoid indole alkaloid (CHEBI:65323) |