EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H46N4O2 |
| Net Charge | 0 |
| Average Mass | 614.834 |
| Monoisotopic Mass | 614.36208 |
| SMILES | [H][C@@]1(C)[C@]23CCCN4CC[C@@]5(c6cccc7c6N(C[C@]68CCN9C/C(=C/C)[C@]%10([H])C[C@@]9([H])[C@]76N(c6ccccc68)[C@]%10([H])C(=O)OC)[C@]15CC2)[C@@]43[H] |
| InChI | InChI=1S/C40H46N4O2/c1-4-25-22-42-19-16-37-23-43-33-28(38-17-20-41-18-8-13-36(35(38)41)14-15-39(38,43)24(36)2)10-7-11-29(33)40(37)31(42)21-26(25)32(34(45)46-3)44(40)30-12-6-5-9-27(30)37/h4-7,9-12,24,26,31-32,35H,8,13-23H2,1-3H3/b25-4-/t24-,26+,31+,32+,35+,36+,37+,38-,39-,40-/m1/s1 |
| InChIKey | NHYWHOQGRJLYBG-ZPMBQDCHSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pleiomutinine (CHEBI:141947) is a monoterpenoid indole alkaloid (CHEBI:65323) |