EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C41H50N4O2 |
| Net Charge | 0 |
| Average Mass | 630.877 |
| Monoisotopic Mass | 630.39338 |
| SMILES | [H][C@]12N3CCC[C@@]14CC[C@]1(N(C)c5ccc([C@]6([H])C[C@@]7(CC)CCCN8CCc9c(n6c6ccccc96)[C@]87[H])cc5[C@]21CC3)[C@]([H])(C(=O)OC)C4 |
| InChI | InChI=1S/C41H50N4O2/c1-4-38-14-7-19-43-21-13-28-27-9-5-6-10-31(27)45(34(28)35(38)43)33(25-38)26-11-12-32-29(23-26)40-18-22-44-20-8-15-39(37(40)44)16-17-41(40,42(32)2)30(24-39)36(46)47-3/h5-6,9-12,23,30,33,35,37H,4,7-8,13-22,24-25H2,1-3H3/t30-,33-,35-,37-,38+,39-,40+,41-/m0/s1 |
| InChIKey | VBJBARRYPHVIMK-PEBDCXOOSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pleiomutine (CHEBI:141946) is a monoterpenoid indole alkaloid (CHEBI:65323) |