EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H28N2O4 |
| Net Charge | 0 |
| Average Mass | 396.487 |
| Monoisotopic Mass | 396.20491 |
| SMILES | [H][C@]12N3CCC[C@]14CC[C@]1([C@H](C(=O)OC)C4)N(C(=O)OC)c4ccccc4C12CC3 |
| InChI | InChI=1S/C23H28N2O4/c1-28-18(26)16-14-21-8-5-12-24-13-11-22(19(21)24)15-6-3-4-7-17(15)25(20(27)29-2)23(16,22)10-9-21/h3-4,6-7,16,19H,5,8-14H2,1-2H3/t16-,19-,21+,22?,23+/m0/s1 |
| InChIKey | SQVLFJQJOPEBAA-ARSIXMPYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pleiocarpine (CHEBI:141940) is a monoterpenoid indole alkaloid (CHEBI:65323) |