EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H26N2O5 |
| Net Charge | 0 |
| Average Mass | 410.470 |
| Monoisotopic Mass | 410.18417 |
| SMILES | [H][C@]12C[C@]3([H])N(C/C1=C/C)[C@]1([H])C[C@]4(c5ccccc5N[C@@]43O1)[C@]2(COC(C)=O)C(=O)OC |
| InChI | InChI=1S/C23H26N2O5/c1-4-14-11-25-18-9-16(14)21(20(27)28-3,12-29-13(2)26)22-10-19(25)30-23(18,22)24-17-8-6-5-7-15(17)22/h4-8,16,18-19,24H,9-12H2,1-3H3/b14-4-/t16-,18-,19-,21-,22-,23-/m0/s1 |
| InChIKey | DXTJMQCRVFWNBD-FTHDSKJGSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Picraline (CHEBI:141938) is a monoterpenoid indole alkaloid (CHEBI:65323) |