EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H36N2O8 |
| Net Charge | 0 |
| Average Mass | 576.646 |
| Monoisotopic Mass | 576.24717 |
| SMILES | [H][C@]1(OC(=O)c2cc(OC)c(OC)c(OC)c2)C23C[C@]4([H])N5C/C(=C/C)[C@]([H])(C[C@@]5([H])[C@@]2([H])N(C)c2ccc(O)cc23)C14C(=O)OC |
| InChI | InChI=1S/C32H36N2O8/c1-7-16-15-34-22-13-19(16)32(30(37)41-6)25(34)14-31(20-12-18(35)8-9-21(20)33(2)27(22)31)29(32)42-28(36)17-10-23(38-3)26(40-5)24(11-17)39-4/h7-12,19,22,25,27,29,35H,13-15H2,1-6H3/b16-7-/t19-,22-,25-,27+,29-,31?,32?/m0/s1 |
| InChIKey | QZYBQHBBKYUFTE-JBLJBMSWSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| O-trimethoxy-3,4,5-benzoyl-OH-vincamajine (CHEBI:141932) is a monoterpenoid indole alkaloid (CHEBI:65323) |