EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20N2O5 |
| Net Charge | 0 |
| Average Mass | 380.400 |
| Monoisotopic Mass | 380.13722 |
| SMILES | CCC1=C(CC(=O)OC)C(OC)(c2nccc3c2nc2ccccc23)OC1=O |
| InChI | InChI=1S/C21H20N2O5/c1-4-12-15(11-17(24)26-2)21(27-3,28-20(12)25)19-18-14(9-10-22-19)13-7-5-6-8-16(13)23-18/h5-10,23H,4,11H2,1-3H3 |
| InChIKey | SHQQHQZXMPJGOJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| O-methylgeissolaevine (CHEBI:141931) is a monoterpenoid indole alkaloid (CHEBI:65323) |