EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H30N2O3 |
| Net Charge | 0 |
| Average Mass | 358.482 |
| Monoisotopic Mass | 358.22564 |
| SMILES | [H][C@]1(CC)CN2CCc3c(nc4cc(OC)c(OC)cc34)[C@]2([H])C[C@]1([H])CCO |
| InChI | InChI=1S/C21H30N2O3/c1-4-13-12-23-7-5-15-16-10-19(25-2)20(26-3)11-17(16)22-21(15)18(23)9-14(13)6-8-24/h10-11,13-14,18,22,24H,4-9,12H2,1-3H3/t13-,14-,18-/m0/s1 |
| InChIKey | CMGYMWAXDJQKLJ-DEYYWGMASA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ochropposinine (CHEBI:141930) is a monoterpenoid indole alkaloid (CHEBI:65323) |