EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H31N4 |
| Net Charge | +1 |
| Average Mass | 447.606 |
| Monoisotopic Mass | 447.25432 |
| SMILES | [H][C@]1(Cc2nccc3c2nc2ccccc23)C[C@@]2([H])c3nc4ccccc4c3CC[N+]2(C)C/C1=C/C |
| InChI | InChI=1S/C30H31N4/c1-3-19-18-34(2)15-13-24-22-9-5-7-11-26(22)33-30(24)28(34)17-20(19)16-27-29-23(12-14-31-27)21-8-4-6-10-25(21)32-29/h3-12,14,20,28,32-33H,13,15-18H2,1-2H3/q+1/b19-3-/t20-,28-,34?/m0/s1 |
| InChIKey | QCLXHLAQWSKUQF-MPMWDDIASA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nb-methylusambarensine (CHEBI:141928) is a monoterpenoid indole alkaloid (CHEBI:65323) |