EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H13N3O |
| Net Charge | 0 |
| Average Mass | 311.344 |
| Monoisotopic Mass | 311.10586 |
| SMILES | O=c1c2cncc3c2c(c2n1CCc1c-2nc2ccccc12)C=C3 |
| InChI | InChI=1S/C20H13N3O/c24-20-15-10-21-9-11-5-6-14(17(11)15)19-18-13(7-8-23(19)20)12-3-1-2-4-16(12)22-18/h1-6,9-10,22H,7-8H2 |
| InChIKey | OLOYVFQOIBGLFJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Naulafine (CHEBI:141927) is a monoterpenoid indole alkaloid (CHEBI:65323) |