EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H27N2O |
| Net Charge | +1 |
| Average Mass | 311.449 |
| Monoisotopic Mass | 311.21179 |
| SMILES | [H][C@]1([C@@]([H])(C=C)CO)CC[N@@+]2(C)CCc3c(nc4ccccc34)[C@]2([H])C1 |
| InChI | InChI=1S/C20H27N2O/c1-3-14(13-23)15-8-10-22(2)11-9-17-16-6-4-5-7-18(16)21-20(17)19(22)12-15/h3-7,14-15,19,21,23H,1,8-13H2,2H3/q+1/t14-,15-,19-,22-/m0/s1 |
| InChIKey | MZLZYEQWGKCFKZ-STAGFUQPSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N4-methylantirhine (CHEBI:141925) is a monoterpenoid indole alkaloid (CHEBI:65323) |