EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C42H46N4O6 |
| Net Charge | 0 |
| Average Mass | 702.852 |
| Monoisotopic Mass | 702.34174 |
| SMILES | [H][C@]12N3CC=C[C@@]1(CC)CC(C(=O)OC)=C1Nc4cc(O)c([C@@]5([H])C=C[C@@]6(CC)CC(C(=O)OC)=C7Nc8c(O)cccc8[C@@]78CCN5[C@@]68[H])cc4[C@@]12CC3 |
| InChI | InChI=1S/C42H46N4O6/c1-5-39-12-8-16-45-17-14-42(37(39)45)27-19-23(31(48)20-28(27)43-33(42)24(21-39)35(49)51-3)29-11-13-40(6-2)22-25(36(50)52-4)34-41(15-18-46(29)38(40)41)26-9-7-10-30(47)32(26)44-34/h7-13,19-20,29,37-38,43-44,47-48H,5-6,14-18,21-22H2,1-4H3/t29-,37+,38+,39+,40+,41+,42+/m1/s1 |
| InChIKey | GLWALLILRDRCHZ-BXAZNEECSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Melosuavine E (CHEBI:141922) is a monoterpenoid indole alkaloid (CHEBI:65323) |