EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H22N3 |
| Net Charge | +1 |
| Average Mass | 304.417 |
| Monoisotopic Mass | 304.18082 |
| SMILES | [H][C@]1(C)c2cnccc2C[C@@]2([H])c3nc4ccccc4c3CC[N@+]12C |
| InChI | InChI=1S/C20H22N3/c1-13-17-12-21-9-7-14(17)11-19-20-16(8-10-23(13,19)2)15-5-3-4-6-18(15)22-20/h3-7,9,12-13,19,22H,8,10-11H2,1-2H3/q+1/t13-,19-,23+/m0/s1 |
| InChIKey | KXNXUEUDDUKJMK-CUKRAGERSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Malindine (CHEBI:141921) is a monoterpenoid indole alkaloid (CHEBI:65323) |