EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H32N2O7 |
| Net Charge | 0 |
| Average Mass | 544.604 |
| Monoisotopic Mass | 544.22095 |
| SMILES | [H][C@]12C[C@]([H])(C(COC(=O)/C=C/c3ccccc3)(C(=O)OC)[C@@]34CC(=O)O[C@]31Nc1ccccc14)[C@@]1(CN2C)OC1C |
| InChI | InChI=1S/C31H32N2O7/c1-19-29(39-19)17-33(2)24-15-23(29)28(27(36)37-3,18-38-25(34)14-13-20-9-5-4-6-10-20)30-16-26(35)40-31(24,30)32-22-12-8-7-11-21(22)30/h4-14,19,23-24,32H,15-18H2,1-3H3/b14-13+/t19?,23-,24+,28?,29+,30+,31+/m1/s1 |
| InChIKey | XWJQTVCPYQVRPY-PRGYTDRISA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Lanciferine (CHEBI:141917) is a monoterpenoid indole alkaloid (CHEBI:65323) |