EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H43N5O |
| Net Charge | 0 |
| Average Mass | 549.763 |
| Monoisotopic Mass | 549.34676 |
| SMILES | [H][C@]1(C[C@@]2([H])c3nc4ccccc4c3CCN2C)C[C@@]2([H])c3nc4c([C@]5([H])CCCN5C)c(O)ccc4c3CCN2C[C@]1([H])C=C |
| InChI | InChI=1S/C35H43N5O/c1-4-21-20-40-17-14-26-24-11-12-31(41)32(28-10-7-15-38(28)2)35(24)37-34(26)30(40)19-22(21)18-29-33-25(13-16-39(29)3)23-8-5-6-9-27(23)36-33/h4-6,8-9,11-12,21-22,28-30,36-37,41H,1,7,10,13-20H2,2-3H3/t21-,22-,28-,29-,30-/m0/s1 |
| InChIKey | PHLJPJICTIGOKC-RZVVXSKCSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Isostrychnopentamine A (CHEBI:141915) is a monoterpenoid indole alkaloid (CHEBI:65323) |