EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26N2O2 |
| Net Charge | 0 |
| Average Mass | 326.440 |
| Monoisotopic Mass | 326.19943 |
| SMILES | [H][C@@]12CN3CCc4c(nc5ccc(OC)cc45)[C@]([H])(C1)[C@]3([H])[C@]([H])([C@H](C)O)C2 |
| InChI | InChI=1S/C20H26N2O2/c1-11(23)15-7-12-8-17-19-14(5-6-22(10-12)20(15)17)16-9-13(24-2)3-4-18(16)21-19/h3-4,9,11-12,15,17,20-21,23H,5-8,10H2,1-2H3/t11-,12-,15-,17-,20-/m0/s1 |
| InChIKey | QLSITYRYHBQHBY-MHUVELHISA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Iboxygaine (CHEBI:141912) is a monoterpenoid indole alkaloid (CHEBI:65323) |