EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H28N2O4 |
| Net Charge | 0 |
| Average Mass | 396.487 |
| Monoisotopic Mass | 396.20491 |
| SMILES | [H][C@]1(OC)OC[C@@]2([H])[C@]3([H])N(C1=O)c1ccccc1[C@@]31CCN(C)C/C(=C/C)[C@]2([H])CC1=O |
| InChI | InChI=1S/C23H28N2O4/c1-4-14-12-24(2)10-9-23-17-7-5-6-8-18(17)25-20(23)16(15(14)11-19(23)26)13-29-22(28-3)21(25)27/h4-8,15-16,20,22H,9-13H2,1-3H3/b14-4-/t15-,16+,20-,22-,23+/m0/s1 |
| InChIKey | MHRUSPYZNNVVHC-QQQSRDQPSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Holstiline (CHEBI:141911) is a monoterpenoid indole alkaloid (CHEBI:65323) |