EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H26N2O4 |
| Net Charge | 0 |
| Average Mass | 382.460 |
| Monoisotopic Mass | 382.18926 |
| SMILES | [H][C@@]12CO[C@H](O)C(=O)N3c4ccccc4[C@@]4(CCN(C)C/C(=C/C)[C@]1([H])CC4=O)[C@@]32[H] |
| InChI | InChI=1S/C22H26N2O4/c1-3-13-11-23(2)9-8-22-16-6-4-5-7-17(16)24-19(22)15(14(13)10-18(22)25)12-28-21(27)20(24)26/h3-7,14-15,19,21,27H,8-12H2,1-2H3/b13-3-/t14-,15+,19-,21-,22+/m0/s1 |
| InChIKey | BLJOXWGKDCMTMU-PGBKOQGOSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Holstiine (CHEBI:141910) is a monoterpenoid indole alkaloid (CHEBI:65323) |