EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H26N2O7 |
| Net Charge | 0 |
| Average Mass | 454.479 |
| Monoisotopic Mass | 454.17400 |
| SMILES | COC(=O)C1C[C@]23C=CC(=O)N2CCC2(C(=O)OC)c4ccccc4N(C(=O)OC)[C@@]12CC3 |
| InChI | InChI=1S/C24H26N2O7/c1-31-19(28)16-14-22-9-8-18(27)25(22)13-12-23(20(29)32-2)15-6-4-5-7-17(15)26(21(30)33-3)24(16,23)11-10-22/h4-9,16H,10-14H2,1-3H3/t16?,22-,23?,24+/m1/s1 |
| InChIKey | VOHFPFMHDXIAOK-XSTYJVQFSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Grandilodine B (CHEBI:141909) is a monoterpenoid indole alkaloid (CHEBI:65323) |