EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H47N4O5 |
| Net Charge | +1 |
| Average Mass | 663.839 |
| Monoisotopic Mass | 663.35410 |
| SMILES | [H][C@@]12C[C@]3([H])N(CC[C@]45C(=O)c6cc7c(cc6O[C@@]43N(c3ccccc35)[C@]1([H])C(=O)OC)N[C@@]13CC[C@@]4(CC)CCC[N@+]1(CC[C@@]73O)C4)C/C2=C/C |
| InChI | InChI=1S/C40H46N4O5/c1-4-24-22-42-16-14-37-27-9-6-7-10-30(27)43-33(35(46)48-3)25(24)20-32(42)40(37,43)49-31-21-29-28(19-26(31)34(37)45)38(47)15-18-44-17-8-11-36(5-2,23-44)12-13-39(38,44)41-29/h4,6-7,9-10,19,21,25,32-33,47H,5,8,11-18,20,22-23H2,1-3H3/p+1/b24-4-/t25-,32-,33-,36+,37-,38+,39-,40+,44-/m0/s1 |
| InChIKey | CBBXXVJTZYTTBO-WNCFEGANSA-O |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Goniomedinone (CHEBI:141906) is a monoterpenoid indole alkaloid (CHEBI:65323) |