EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H48N4O3 |
| Net Charge | 0 |
| Average Mass | 632.849 |
| Monoisotopic Mass | 632.37264 |
| SMILES | [H][C@]12C[C@]3([H])/C(=C\C)CN1CC[C@]14Cc5cc6c7c(nc6cc5O[C@@]12N(c1ccccc14)[C@]3([H])C(=O)OC)CC[C@@]1(CC)CCCN(CC7)C1 |
| InChI | InChI=1S/C40H48N4O3/c1-4-25-23-43-18-15-39-22-26-19-29-27-12-17-42-16-8-13-38(5-2,24-42)14-11-31(27)41-32(29)21-34(26)47-40(39)35(43)20-28(25)36(37(45)46-3)44(40)33-10-7-6-9-30(33)39/h4,6-7,9-10,19,21,28,35-36,41H,5,8,11-18,20,22-24H2,1-3H3/b25-4-/t28-,35-,36+,38-,39-,40-/m1/s1 |
| InChIKey | FXNSZAOKKBWFLU-ZFNFFTCCSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Goniomedine B (CHEBI:141905) is a monoterpenoid indole alkaloid (CHEBI:65323) |