EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C40H49N4O4 |
| Net Charge | +1 |
| Average Mass | 649.856 |
| Monoisotopic Mass | 649.37483 |
| SMILES | [H][C@@]12C[C@]3([H])N(CC[C@]45Cc6cc7c(cc6O[C@@]43N(c3ccccc35)[C@]1([H])C(=O)OC)N[C@@]13CC[C@@]4(CC)CCC[N@+]1(CC[C@@]73O)C4)C/C2=C/C |
| InChI | InChI=1S/C40H49N4O4/c1-4-25-23-42-16-14-37-22-26-19-29-30(41-39-13-12-36(5-2)11-8-17-44(39,24-36)18-15-38(29,39)46)21-32(26)48-40(37)33(42)20-27(25)34(35(45)47-3)43(40)31-10-7-6-9-28(31)37/h4,6-7,9-10,19,21,27,33-34,41,46H,5,8,11-18,20,22-24H2,1-3H3/q+1/b25-4-/t27-,33-,34-,36+,37+,38+,39-,40+,44-/m0/s1 |
| InChIKey | HXSUIFJHKMZLGO-GKYHKFLCSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Goniomedine A (CHEBI:141904) is a monoterpenoid indole alkaloid (CHEBI:65323) |