EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H44N4O |
| Net Charge | 0 |
| Average Mass | 572.797 |
| Monoisotopic Mass | 572.35151 |
| SMILES | [H][C@@]1(CC)CN2CC[C@]34c5ccccc5N5[C@@]3([H])[C@@]([H])(CO[C@@]5([H])C3[C@]5([H])Cc6c(nc7ccccc67)[C@]6([H])C[C@]3([H])/C(=C\C)CN65)[C@@]1([H])C[C@@]24[H] |
| InChI | InChI=1S/C38H44N4O/c1-3-21-18-40-14-13-38-28-10-6-8-12-30(28)42-36(38)27(24(21)17-33(38)40)20-43-37(42)34-25-15-32-35-26(23-9-5-7-11-29(23)39-35)16-31(34)41(32)19-22(25)4-2/h4-12,21,24-25,27,31-34,36-37,39H,3,13-20H2,1-2H3/b22-4-/t21-,24+,25-,27+,31+,32+,33-,34?,36+,37+,38-/m1/s1 |
| InChIKey | CSVWQRLFFUNUND-UFEKRQKTSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Geissolosimine (CHEBI:141903) is a monoterpenoid indole alkaloid (CHEBI:65323) |