EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H20N2O |
| Net Charge | 0 |
| Average Mass | 292.382 |
| Monoisotopic Mass | 292.15756 |
| SMILES | [H][C@@]12CC(=O)c3nc4ccccc4c3[C@@]([H])(C1=C)N(C)C/C2=C/C |
| InChI | InChI=1S/C19H20N2O/c1-4-12-10-21(3)19-11(2)14(12)9-16(22)18-17(19)13-7-5-6-8-15(13)20-18/h4-8,14,19-20H,2,9-10H2,1,3H3/b12-4-/t14-,19-/m1/s1 |
| InChIKey | IIVNFAVESMLIIL-IULYYSJBSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ervitsine (CHEBI:141901) is a monoterpenoid indole alkaloid (CHEBI:65323) |