EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H26N2O |
| Net Charge | 0 |
| Average Mass | 298.430 |
| Monoisotopic Mass | 298.20451 |
| SMILES | [H][C@]1(CCO)C[C@@]2([H])c3nc4ccccc4c3CCN2C[C@@]1([H])CC |
| InChI | InChI=1S/C19H26N2O/c1-2-13-12-21-9-7-16-15-5-3-4-6-17(15)20-19(16)18(21)11-14(13)8-10-22/h3-6,13-14,18,20,22H,2,7-12H2,1H3/t13-,14+,18+/m1/s1 |
| InChIKey | KBMIVGVAJKVWBU-GLJUWKHASA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Corynantheidol (CHEBI:141890) is a monoterpenoid indole alkaloid (CHEBI:65323) |