EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H22N2O3 |
| Net Charge | 0 |
| Average Mass | 338.407 |
| Monoisotopic Mass | 338.16304 |
| SMILES | [H][C@]12/C(=C\C)C3CC[N@@+]1([O-])CC[C@@]21C(=C3C(=O)OC)Nc2ccccc21 |
| InChI | InChI=1S/C20H22N2O3/c1-3-12-13-8-10-22(24)11-9-20(18(12)22)14-6-4-5-7-15(14)21-17(20)16(13)19(23)25-2/h3-7,13,18,21H,8-11H2,1-2H3/b12-3-/t13?,18-,20-,22-/m1/s1 |
| InChIKey | VSVUYWHJSOBUDT-BFPRUOFYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Condylocarpine N-oxide (CHEBI:141887) is a monoterpenoid indole alkaloid (CHEBI:65323) |