EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H25N2O |
| Net Charge | +1 |
| Average Mass | 309.433 |
| Monoisotopic Mass | 309.19614 |
| SMILES | [H][C@@]12C[C@@]3([H])c4c(c5ccccc5n4C1CO)CC[N+]3(C)C/C2=C/C |
| InChI | InChI=1S/C20H25N2O/c1-3-13-11-22(2)9-8-15-14-6-4-5-7-17(14)21-18(12-23)16(13)10-19(22)20(15)21/h3-7,16,18-19,23H,8-12H2,1-2H3/q+1/b13-3-/t16-,18?,19-,22?/m0/s1 |
| InChIKey | HFLUPWJGJPYITM-GTGFZELSSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| C-mavacurine (CHEBI:141886) is a monoterpenoid indole alkaloid (CHEBI:65323) |