EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H36N4O2 |
| Net Charge | 0 |
| Average Mass | 496.655 |
| Monoisotopic Mass | 496.28383 |
| SMILES | [H][C@]1(c2ccc3c(CCN)cnc3c2)C[C@]2([H])/C(=C\C)CN(C)[C@@]([H])(Cc3c1nc1ccccc31)C2C(=O)OC |
| InChI | InChI=1S/C31H36N4O2/c1-4-18-17-35(2)28-15-25-22-7-5-6-8-26(22)34-30(25)24(14-23(18)29(28)31(36)37-3)19-9-10-21-20(11-12-32)16-33-27(21)13-19/h4-10,13,16,23-24,28-29,33-34H,11-12,14-15,17,32H2,1-3H3/b18-4-/t23-,24-,28+,29?/m1/s1 |
| InChIKey | ZOBHQOIVLKIBTQ-SBSBCDAMSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ceridimine (CHEBI:141883) is a monoterpenoid indole alkaloid (CHEBI:65323) |