EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H26N2O4 |
| Net Charge | 0 |
| Average Mass | 394.471 |
| Monoisotopic Mass | 394.18926 |
| SMILES | [H][C@@]12C[C@@]3([H])/C(=C\C)CN1CC[C@@]1(C2=Nc2ccccc21)C3(COC(C)=O)C(=O)OC |
| InChI | InChI=1S/C23H26N2O4/c1-4-15-12-25-10-9-22-16-7-5-6-8-18(16)24-20(22)19(25)11-17(15)23(22,21(27)28-3)13-29-14(2)26/h4-8,17,19H,9-13H2,1-3H3/b15-4-/t17-,19-,22+,23?/m0/s1 |
| InChIKey | QBHALCZZZWCCLV-AATGQAFQSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Akuammiline (CHEBI:141879) is a monoterpenoid indole alkaloid (CHEBI:65323) |
| UniProt Name | Source |
|---|---|
| akuammiline | UniProt |