EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:141878 - akuammigine
| Formula | C21H24N2O3 |
| Net Charge | 0 |
| Average Mass | 352.434 |
| Monoisotopic Mass | 352.17869 |
| SMILES | [H][C@@]12CN3CCc4c(nc5ccccc45)[C@@]3([H])C[C@]1([H])C(C(=O)OC)=CO[C@H]2C |
| InChI | InChI=1S/C21H24N2O3/c1-12-16-10-23-8-7-14-13-5-3-4-6-18(13)22-20(14)19(23)9-15(16)17(11-26-12)21(24)25-2/h3-6,11-12,15-16,19,22H,7-10H2,1-2H3/t12-,15-,16-,19+/m0/s1 |
| InChIKey | GRTOGORTSDXSFK-BMYCAMMWSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Uncaria rhynchophylla (ncbitaxon:43575) | - | PubMed (24899363) | Isolated from hook-bearing branches. |
| Vinca sardoa (IPNI:82711-1) | aerial part (BTO:0001658) | Article (Nicoletti, M., Serafini, M., Federici, E., Galeffi, C. and Poli, F. (1998) Indole alkaloids from aerial parts of Vinca sardoa. Phytochemistry, 47(1), 149-151.) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| akuammigine (CHEBI:141878) has role plant metabolite (CHEBI:76924) |
| akuammigine (CHEBI:141878) is a methyl ester (CHEBI:25248) |
| akuammigine (CHEBI:141878) is a monoterpenoid indole alkaloid (CHEBI:65323) |
| akuammigine (CHEBI:141878) is a organic heteropentacyclic compound (CHEBI:38164) |
| IUPAC Name |
|---|
| methyl (3β,19α,20α)-19-methyl-16,17-didehydro-18-oxayohimban-16-carboxylate |
| Synonym | Source |
|---|---|
| akuammigine | ChemIDplus |
| Citations |
|---|