EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C43H52N4O6 |
| Net Charge | 0 |
| Average Mass | 720.911 |
| Monoisotopic Mass | 720.38869 |
| SMILES | [H][C@@]12C[C@]([H])(CC)[C@]3([H])N(CCc4c(nc5cc(OC)c([C@@]6([H])CC7[C@]([H])(CC)CN(C)C(Cc8c6nc6ccccc86)[C@@]7([H])C(=O)OC)cc45)[C@]3(C(=O)OC)C1)C2=O |
| InChI | InChI=1S/C43H52N4O6/c1-7-22-15-24-20-43(42(50)53-6)38-26(13-14-47(39(22)43)40(24)48)28-17-29(35(51-4)19-33(28)45-38)30-16-27-23(8-2)21-46(3)34(36(27)41(49)52-5)18-31-25-11-9-10-12-32(25)44-37(30)31/h9-12,17,19,22-24,27,30,34,36,39,44-45H,7-8,13-16,18,20-21H2,1-6H3/t22-,23+,24+,27?,30+,34?,36-,39-,43+/m0/s1 |
| InChIKey | GCFJFNCWQHDGOL-QTGVYYSLSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3'-oxotabernaelegantine B (CHEBI:141873) is a monoterpenoid indole alkaloid (CHEBI:65323) |