EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H32N2O10 |
| Net Charge | 0 |
| Average Mass | 544.557 |
| Monoisotopic Mass | 544.20570 |
| SMILES | [H][C@@]1(OC2OC(CO)C(O)C(O)C2O)OC=C(C(=O)OC)[C@@]2([H])C[C@@]34O[C@]([H])(CN3CCc3c4nc4ccccc34)[C@@]12[H] |
| InChI | InChI=1S/C27H32N2O10/c1-35-24(34)15-11-36-25(38-26-22(33)21(32)20(31)18(10-30)37-26)19-14(15)8-27-23-13(6-7-29(27)9-17(19)39-27)12-4-2-3-5-16(12)28-23/h2-5,11,14,17-22,25-26,28,30-33H,6-10H2,1H3/t14-,17-,18?,19+,20?,21?,22?,25+,26?,27+/m1/s1 |
| InChIKey | OVRROYYXOBYCSR-OTZSZKQMSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cadambine (CHEBI:141872) is a monoterpenoid indole alkaloid (CHEBI:65323) |