EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H20N2O |
| Net Charge | 0 |
| Average Mass | 292.382 |
| Monoisotopic Mass | 292.15756 |
| SMILES | [H][C@]12N3CC=C[C@@]1(C=C)C[C@@]1([H])C(O)=Nc4ccccc4[C@]21CC3 |
| InChI | InChI=1S/C19H20N2O/c1-2-18-8-5-10-21-11-9-19(17(18)21)13-6-3-4-7-15(13)20-16(22)14(19)12-18/h2-8,14,17H,1,9-12H2,(H,20,22)/t14-,17-,18-,19-/m0/s1 |
| InChIKey | BEMFQIDPZLYEBJ-QZHFEQFPSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-epimeloscine (CHEBI:141871) is a monoterpenoid indole alkaloid (CHEBI:65323) |