EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H39N4O |
| Net Charge | +1 |
| Average Mass | 567.757 |
| Monoisotopic Mass | 567.31184 |
| SMILES | [H][C@@]12[C@H](O)C([C@@]3([H])Cc4c5nc6ccccc6c5cc[n+]4C/C3=C/C)=CN3c4ccccc4[C@@]4(CCN5C/C(=C/C)[C@]1([H])C[C@]54[H])[C@@]32[H] |
| InChI | InChI=1S/C38H38N4O/c1-3-22-19-40-15-13-25-24-9-5-7-11-30(24)39-35(25)32(40)17-26(22)28-21-42-31-12-8-6-10-29(31)38-14-16-41-20-23(4-2)27(18-33(38)41)34(36(28)43)37(38)42/h3-13,15,21,26-27,33-34,36-37,43H,14,16-20H2,1-2H3/p+1/b22-3-,23-4-/t26-,27-,33-,34-,36+,37-,38+/m0/s1 |
| InChIKey | INVOSXVUPRCXKV-JGGOXZBPSA-O |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3',4',5',6'-tetradehydrolongicaudatine Y (CHEBI:141869) is a monoterpenoid indole alkaloid (CHEBI:65323) |