EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H21N2O |
| Net Charge | +1 |
| Average Mass | 293.390 |
| Monoisotopic Mass | 293.16484 |
| SMILES | C/C=C1/C[n+]2ccc3c(nc4ccccc43)c2CC1CCO |
| InChI | InChI=1S/C19H20N2O/c1-2-13-12-21-9-7-16-15-5-3-4-6-17(15)20-19(16)18(21)11-14(13)8-10-22/h2-7,9,14,22H,8,10-12H2,1H3/p+1/b13-2- |
| InChIKey | ICJZOHPEKMAUGQ-SILLCRNTSA-O |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3,4,5,6-tetradehydrogeissoschizol (CHEBI:141868) is a monoterpenoid indole alkaloid (CHEBI:65323) |