EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H34N4O |
| Net Charge | 0 |
| Average Mass | 466.629 |
| Monoisotopic Mass | 466.27326 |
| SMILES | [H][C@]1(C[C@]2([H])c3nc4ccccc4c3CCN2C)C[C@@]2([H])c3nc4cc(O)ccc4c3CCN2C[C@]1([H])C=C |
| InChI | InChI=1S/C30H34N4O/c1-3-18-17-34-13-11-24-22-9-8-20(35)16-26(22)32-30(24)28(34)15-19(18)14-27-29-23(10-12-33(27)2)21-6-4-5-7-25(21)31-29/h3-9,16,18-19,27-28,31-32,35H,1,10-15,17H2,2H3/t18-,19-,27+,28-/m0/s1 |
| InChIKey | DGQWMSVZRIPJMR-YBTNASEBSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 11-hydroxyusambarine (CHEBI:141859) is a monoterpenoid indole alkaloid (CHEBI:65323) |