EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H24N2O2 |
| Net Charge | 0 |
| Average Mass | 312.413 |
| Monoisotopic Mass | 312.18378 |
| SMILES | C/C=C1/CN2CCc3c(nc4ccc(O)cc34)C2CC1CCO |
| InChI | InChI=1S/C19H24N2O2/c1-2-12-11-21-7-5-15-16-10-14(23)3-4-17(16)20-19(15)18(21)9-13(12)6-8-22/h2-4,10,13,18,20,22-23H,5-9,11H2,1H3/b12-2- |
| InChIKey | KLYKGWYHZKEJOS-OIXVIMQBSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 10-hydroxygeissoschizol (CHEBI:141857) is a monoterpenoid indole alkaloid (CHEBI:65323) |