EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H20N6O2 |
| Net Charge | 0 |
| Average Mass | 304.354 |
| Monoisotopic Mass | 304.16477 |
| SMILES | CC(C)=CCNc1ncn(CC[C@H](N)C(=O)O)c2ncnc1-2 |
| InChI | InChI=1S/C14H20N6O2/c1-9(2)3-5-16-12-11-13(18-7-17-11)20(8-19-12)6-4-10(15)14(21)22/h3,7-8,10,16H,4-6,15H2,1-2H3,(H,21,22)/t10-/m0/s1 |
| InChIKey | KGVAAXZLUAKZEO-JTQLQIEISA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| discadenine (CHEBI:15955) has functional parent butyric acid (CHEBI:30772) |
| discadenine (CHEBI:15955) is a 6-isopentenylaminopurine (CHEBI:38643) |
| discadenine (CHEBI:15955) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| discadenine (CHEBI:15955) is conjugate acid of discadenine(1−) (CHEBI:62934) |
| discadenine (CHEBI:15955) is tautomer of discadenine zwitterion (CHEBI:57585) |
| Incoming Relation(s) |
| discadenine(1−) (CHEBI:62934) is conjugate base of discadenine (CHEBI:15955) |
| discadenine zwitterion (CHEBI:57585) is tautomer of discadenine (CHEBI:15955) |
| IUPAC Name |
|---|
| (2S)-2-amino-4-{6-[(3-methylbut-2-en-1-yl)amino]-3H-purin-3-yl}butanoic acid |
| Synonyms | Source |
|---|---|
| 3-(3-Amino-3-carboxypropyl)-N6-(delta2-isopentenyl)-adenine | KEGG COMPOUND |
| 3-(3-amino-3-carboxypropyl)-N6-(delta2)-isopentenyladenine | ChEBI |
| alpha-amino-6-((3-methyl-2-butenyl)amino)-3H-purine-3-butanoic acid | ChEBI |
| Discadenine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C01804 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| CAS:69832-12-8 | KEGG COMPOUND |
| Citations |
|---|