EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H32 |
| Net Charge | 0 |
| Average Mass | 272.476 |
| Monoisotopic Mass | 272.25040 |
| SMILES | [H][C@]12CC[C@]3(C)C(=C)CCC[C@@]3([H])[C@]1(C)CC[C@](C)(C=C)C2 |
| InChI | InChI=1S/C20H32/c1-6-18(3)12-13-20(5)16(14-18)10-11-19(4)15(2)8-7-9-17(19)20/h6,16-17H,1-2,7-14H2,3-5H3/t16-,17-,18+,19-,20-/m1/s1 |
| InChIKey | GHYZJFFJSPZRIU-OUUBHVDSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Thujopsis dolabrata (ncbitaxon:13727) | leaf (BTO:0000713) | PubMed (11412956) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dolabradiene (CHEBI:141822) has role plant metabolite (CHEBI:76924) |
| dolabradiene (CHEBI:141822) is a carbotricyclic compound (CHEBI:38032) |
| dolabradiene (CHEBI:141822) is a diterpene (CHEBI:35190) |
| dolabradiene (CHEBI:141822) is a olefinic compound (CHEBI:78840) |
| Incoming Relation(s) |
| 15,16-epoxydolabrene (CHEBI:141821) has functional parent dolabradiene (CHEBI:141822) |
| IUPAC Name |
|---|
| (4aS,4bR,7S,8aR,10aS)-4b,7,10a-trimethyl-1-methylene-7-vinyltetradecahydrophenanthrene |
| UniProt Name | Source |
|---|---|
| dolabradiene | UniProt |
| Citations |
|---|