EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H7O7 |
| Net Charge | -3 |
| Average Mass | 203.126 |
| Monoisotopic Mass | 203.02082 |
| SMILES | CC(O)(C(=O)[O-])C(CC(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C7H10O7/c1-7(14,6(12)13)3(5(10)11)2-4(8)9/h3,14H,2H2,1H3,(H,8,9)(H,10,11)(H,12,13)/p-3 |
| InChIKey | HHKPKXCSHMJWCF-UHFFFAOYSA-K |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-hydroxybutane-1,2,3-tricarboxylate (CHEBI:141790) is a tricarboxylic acid trianion (CHEBI:27092) |
| 3-hydroxybutane-1,2,3-tricarboxylate (CHEBI:141790) is conjugate base of 3-hydroxybutane-1,2,3-tricarboxylic acid (CHEBI:142525) |
| Incoming Relation(s) |
| (2S,3R)-3-hydroxybutane-1,2,3-tricarboxylate (CHEBI:57429) is a 3-hydroxybutane-1,2,3-tricarboxylate (CHEBI:141790) |
| 3-hydroxybutane-1,2,3-tricarboxylic acid (CHEBI:142525) is conjugate acid of 3-hydroxybutane-1,2,3-tricarboxylate (CHEBI:141790) |
| IUPAC Name |
|---|
| 3-hydroxybutane-1,2,3-tricarboxylate |
| Synonym | Source |
|---|---|
| 1-hydroxy-1-methylpropane-1,2,3-tricarboxylate | SUBMITTER |
| UniProt Name | Source |
|---|---|
| 3-hydroxybutane-1,2,3-tricarboxylate | UniProt |
| Citations |
|---|