EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H21NO3 |
| Net Charge | 0 |
| Average Mass | 311.381 |
| Monoisotopic Mass | 311.15214 |
| SMILES | CO[C@@H]1[C@@H](c2ccccc2)[C@@H](c2ccccc2)[C@H](O)C(=O)N1C |
| InChI | InChI=1S/C19H21NO3/c1-20-18(22)17(21)15(13-9-5-3-6-10-13)16(19(20)23-2)14-11-7-4-8-12-14/h3-12,15-17,19,21H,1-2H3/t15-,16+,17+,19-/m1/s1 |
| InChIKey | HGOXSQCBJLZRJO-VUHPKUFZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Clausena lansium (ncbitaxon:159037) | leaf (BTO:0000713) | PubMed (26523463) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Lansamide 4 (CHEBI:141771) has role plant metabolite (CHEBI:76924) |
| Lansamide 4 (CHEBI:141771) is a 3-hydroxy-6-methoxy-1-methyl-4,5-diphenyl-2-piperidinone (CHEBI:141548) |
| IUPAC Name |
|---|
| (3S,4S,5R,6R)-3-hydroxy-6-methoxy-1-methyl-4,5-diphenylpiperidin-2-one |
| Synonyms | Source |
|---|---|
| lansamide 4 | HMDB |
| lansimide 4 | HMDB |
| Manual Xrefs | Databases |
|---|---|
| FDB013108 | FooDB |
| HMDB0034592 | HMDB |
| Citations |
|---|