EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H19O9 |
| Net Charge | -1 |
| Average Mass | 355.319 |
| Monoisotopic Mass | 355.10346 |
| SMILES | COc1cc(/C=C/C(=O)[O-])ccc1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C16H20O9/c1-23-10-6-8(3-5-12(18)19)2-4-9(10)24-16-15(22)14(21)13(20)11(7-17)25-16/h2-6,11,13-17,20-22H,7H2,1H3,(H,18,19)/p-1/b5-3+/t11-,13-,14+,15-,16-/m1/s1 |
| InChIKey | IEMIRSXOYFWPFD-BJGSYIFTSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-O-β-D-glucosyl-trans-ferulate (CHEBI:141767) is a monocarboxylic acid anion (CHEBI:35757) |
| 4-O-β-D-glucosyl-trans-ferulate (CHEBI:141767) is conjugate base of 4-O-β-D-glucosyl-trans-ferulic acid (CHEBI:139435) |
| Incoming Relation(s) |
| 4-O-β-D-glucosyl-trans-ferulic acid (CHEBI:139435) is conjugate acid of 4-O-β-D-glucosyl-trans-ferulate (CHEBI:141767) |
| UniProt Name | Source |
|---|---|
| 4-O-β-D-glucosyl-trans-ferulate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-26835 | MetaCyc |
| Citations |
|---|