EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H24N2 |
| Net Charge | 0 |
| Average Mass | 304.437 |
| Monoisotopic Mass | 304.19395 |
| SMILES | [H][C@@]12c3cnc4cccc(c34)C(C)(C)[C@@]1([H])CC[C@](C)(C=C)[C@@H]2[N+]#[C-] |
| InChI | InChI=1S/C21H24N2/c1-6-21(4)11-10-15-18(19(21)22-5)13-12-23-16-9-7-8-14(17(13)16)20(15,2)3/h6-9,12,15,18-19,23H,1,10-11H2,2-4H3/t15-,18+,19+,21-/m0/s1 |
| InChIKey | SLUFHMQYBPOTFZ-ZRRCRCOKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hapalosiphon delicatulus (ncbitaxon:210996) | - | PubMed (9784177) | UH isolate IC-13-1 |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hapalindole U (CHEBI:141613) is a hapalindole (CHEBI:141617) |
| hapalindole U (CHEBI:141613) is a isocyanide (CHEBI:35353) |
| hapalindole U (CHEBI:141613) is a organic heterotetracyclic compound (CHEBI:38163) |
| IUPAC Name |
|---|
| (6aS,9R,10R,10aS)-10-isocyano-6,6,9-trimethyl-9-vinyl-2,6,6a,7,8,9,10,10a-octahydronaphtho[1,2,3-cd]indole |
| UniProt Name | Source |
|---|---|
| hapalindole U | UniProt |
| Registry Numbers | Sources |
|---|---|
| CAS:106928-30-7 | KNApSAcK |
| CAS:106928-30-7 | PubChem Compound |
| Citations |
|---|