EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H44O15 |
| Net Charge | 0 |
| Average Mass | 692.711 |
| Monoisotopic Mass | 692.26802 |
| SMILES | C[C@@H]1OC(=O)[C@@H](C2([C@H]3CC(=O)CC[C@H](C)OC(=O)/C=C/[C@@H](O)[C@H](C)OC3=O)C(=O)C[C@H](C)OC2=O)CC(=O)CC[C@H](C)OC(=O)/C=C/[C@H]1O |
| InChI | InChI=1S/C34H44O15/c1-17-6-8-22(35)15-24(31(42)48-20(4)26(37)10-12-29(40)45-17)34(28(39)14-19(3)47-33(34)44)25-16-23(36)9-7-18(2)46-30(41)13-11-27(38)21(5)49-32(25)43/h10-13,17-21,24-27,37-38H,6-9,14-16H2,1-5H3/b12-10+,13-11+/t17-,18-,19-,20-,21-,24-,25-,26+,27+/m0/s1 |
| InChIKey | WPPOFQTZLGPDIZ-VPNZNENOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Acaulium sp. (ncbitaxon:1960041) | - | PubMed (29376657 ) | Strain: H-JQSF |
| Roles Classification |
|---|
| Biological Role: | osteogenesis regulator Any compound that induces or regulates osteogenesis. |
| Application: | bone density conservation agent An agent that inhibits bone resorption and/or favor bone mineralization and bone regeneration. Used to heal bone fractures and to treat bone diseases such as osteopenia and osteoporosis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acaulide (CHEBI:141600) has role bone density conservation agent (CHEBI:50646) |
| acaulide (CHEBI:141600) has role osteogenesis regulator (CHEBI:63054) |
| acaulide (CHEBI:141600) is a cyclic ketone (CHEBI:3992) |
| acaulide (CHEBI:141600) is a macrodiolide (CHEBI:145556) |
| acaulide (CHEBI:141600) is a secondary alcohol (CHEBI:35681) |
| acaulide (CHEBI:141600) is a triketone (CHEBI:140322) |
| IUPAC Name |
|---|
| (3E,5R,6S,9R,14S,3'E,5'R,6'S,9'R,14'S)-9,9'-[(6S)-6-methyl-2,4-dioxotetrahydro-2H-pyran-3,3-diyl]bis(5-hydroxy-6,14-dimethyl-1,7-dioxacyclotetradec-3-ene-2,8,11-trione) |
| Citations |
|---|