EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H16O9 |
| Net Charge | 0 |
| Average Mass | 268.218 |
| Monoisotopic Mass | 268.07943 |
| SMILES | O=C(O)[C@@H](CO)O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O |
| WURCS | WURCS=2.0/1,1,0/[a1122h-1b_1-5_1*OC^RCO/4=O/3CO]/1/ |
| InChI | InChI=1S/C9H16O9/c10-1-3-5(12)6(13)7(14)9(17-3)18-4(2-11)8(15)16/h3-7,9-14H,1-2H2,(H,15,16)/t3-,4-,5-,6+,7+,9+/m1/s1 |
| InChIKey | DDXCFDOPXBPUJC-MTXRGOKVSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(β-D-mannosyl)-D-glyceric acid (CHEBI:141585) has functional parent β-D-mannose (CHEBI:28563) |
| 2-(β-D-mannosyl)-D-glyceric acid (CHEBI:141585) is a D-mannosyl-D-glyceric acid (CHEBI:60940) |
| IUPAC Name |
|---|
| (2R)-3-hydroxy-2-(β-D-mannopyranosyloxy)propanoic acid |
| Synonyms | Source |
|---|---|
| (2R)-3-hydroxy-2-{[(2S,3S,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl]oxy}propanoic acid | IUPAC |
| (2R)-3-Hydroxy-2-(β-D-mannopyranosyloxy)propansäure | ChEBI |
| (2R)-O2-(β-D-mannopyranosyl)glyceric acid | ChEBI |
| 2-(β-D-mannosyl)-D-glyceric acid | ChEBI |
| firoin | ChEBI |
| propanoic acid, 3-hydroxy-2-(β-D-mannopyranosyloxy)-, (2R)- | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 57546265 | ChemSpider |
| US2005100534 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15489813 | Reaxys |
| Citations |
|---|