EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H18 |
| Net Charge | 0 |
| Average Mass | 126.243 |
| Monoisotopic Mass | 126.14085 |
| SMILES | C=C(C)CC(C)CCC |
| InChI | InChI=1S/C9H18/c1-5-6-9(4)7-8(2)3/h9H,2,5-7H2,1,3-4H3 |
| InChIKey | CZGAOHSMVSIJJZ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | cell suspension culture (BTO:0000221) | PubMed (20056637) | Detected in human lung cancer cell line. |
| Sus scrofa domesticus (ncbitaxon:9825) | - | PubMed (17995825) | Detected in fresh pork loin and belly cuts. |
| Roles Classification |
|---|
| Biological Roles: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2,4-dimethyl-1-heptene (CHEBI:141563) has parent hydride heptane (CHEBI:43098) |
| 2,4-dimethyl-1-heptene (CHEBI:141563) has role animal metabolite (CHEBI:75767) |
| 2,4-dimethyl-1-heptene (CHEBI:141563) has role human metabolite (CHEBI:77746) |
| 2,4-dimethyl-1-heptene (CHEBI:141563) is a alkene (CHEBI:32878) |
| 2,4-dimethyl-1-heptene (CHEBI:141563) is a volatile organic compound (CHEBI:134179) |
| IUPAC Name |
|---|
| 2,4-dimethylhept-1-ene |
| Synonyms | Source |
|---|---|
| 2,4-Dimethyl-1-hepten | ChEBI |
| 2,4-dimethyl-1-heptene | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1736468 | Reaxys |
| CAS:19549-87-2 | ChemIDplus |
| CAS:19549-87-2 | NIST Chemistry WebBook |
| Citations |
|---|