EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H28N8 |
| Net Charge | 0 |
| Average Mass | 416.533 |
| Monoisotopic Mass | 416.24369 |
| SMILES | CCCCc1nc(CCCC)n(Cc2ccc(-c3ccccc3-c3nnnn3)nc2)n1 |
| InChI | InChI=1S/C23H28N8/c1-3-5-11-21-25-22(12-6-4-2)31(28-21)16-17-13-14-20(24-15-17)18-9-7-8-10-19(18)23-26-29-30-27-23/h7-10,13-15H,3-6,11-12,16H2,1-2H3,(H,26,27,29,30) |
| InChIKey | YONOBYIBNBCDSJ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | angiotensin receptor antagonist A hormone antagonist that blocks angiotensin receptors. |
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. angiotensin receptor antagonist A hormone antagonist that blocks angiotensin receptors. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| forasartan (CHEBI:141552) has role angiotensin receptor antagonist (CHEBI:61016) |
| forasartan (CHEBI:141552) has role antihypertensive agent (CHEBI:35674) |
| forasartan (CHEBI:141552) is a benzenes (CHEBI:22712) |
| forasartan (CHEBI:141552) is a pyridines (CHEBI:26421) |
| forasartan (CHEBI:141552) is a tetrazoles (CHEBI:35689) |
| forasartan (CHEBI:141552) is a triazoles (CHEBI:35727) |
| IUPAC Name |
|---|
| 5-[(3,5-dibutyl-1H-1,2,4-triazol-1-yl)methyl]-2-[2-(1H-tetrazol-5-yl)phenyl]pyridine |
| INNs | Source |
|---|---|
| forasartan | WHO MedNet |
| forasartan | ChemIDplus |
| forasartán | WHO MedNet |
| forasartanum | WHO MedNet |
| Synonyms | Source |
|---|---|
| SC 52458 | ChemIDplus |
| SC-52458 | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| D04243 | KEGG DRUG |
| DB01342 | DrugBank |
| Forasartan | Wikipedia |
| HMDB0015434 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9361619 | Reaxys |
| CAS:145216-43-9 | ChemIDplus |
| Citations |
|---|