EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H20FN3.HCl |
| Net Charge | 0 |
| Average Mass | 345.849 |
| Monoisotopic Mass | 345.14080 |
| SMILES | Cl.Fc1ccc2nc3c(c2c1)CN(CCCc1cccnc1)CC3 |
| InChI | InChI=1S/C19H20FN3.ClH/c20-15-5-6-18-16(11-15)17-13-23(10-7-19(17)22-18)9-2-4-14-3-1-8-21-12-14;/h1,3,5-6,8,11-12,22H,2,4,7,9-10,13H2;1H |
| InChIKey | KJROJWRPNPSEGV-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | dopamine receptor D2 antagonist An antagonist that binds to and deactivates the dopamine receptor D2, the main receptor for all antipsychotic drugs. |
| Application: | antipsychotic agent Antipsychotic drugs are agents that control agitated psychotic behaviour, alleviate acute psychotic states, reduce psychotic symptoms, and exert a quieting effect. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| gevotroline hydrochloride (CHEBI:141549) has part gevotroline(1+) (CHEBI:142392) |
| gevotroline hydrochloride (CHEBI:141549) has role antipsychotic agent (CHEBI:35476) |
| gevotroline hydrochloride (CHEBI:141549) has role dopamine receptor D2 antagonist (CHEBI:131787) |
| gevotroline hydrochloride (CHEBI:141549) is a hydrochloride (CHEBI:36807) |
| IUPAC Name |
|---|
| 8-fluoro-2-[3-(pyridin-3-yl)propyl]-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole hydrochloride |
| Synonyms | Source |
|---|---|
| gevotroline HCl | ChemIDplus |
| 8-fluoro-2,3,4,5-tetrahydro-2-(3-(3-pyridyl)propyl)-1H-pyrido(4,3-b)indole monohydrochloride | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15397146 | Reaxys |
| CAS:112243-58-0 | KEGG DRUG |
| CAS:112243-58-0 | ChemIDplus |
| Citations |
|---|